C31H38F3N5O13 — CID 163320742
[(2S,3R,4R)-2,3,4-triacetyloxy-5-[3-[2-(2-aminoethoxy)ethyl]-7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl]pentyl] acetate;2,2,2-trifluoroacetic acid (PubChem CID 163320742) has the molecular formula C31H38F3N5O13 and a molecular weight of 745.66 g/mol. Its IUPAC name is [(2S,3R,4R)-2,3,4-triacetyloxy-5-[3-[2-(2-aminoethoxy)ethyl]-7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl]pentyl] acetate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,3R,4R)-2,3,4-triacetyloxy-5-[3-[2-(2-aminoethoxy)ethyl]-7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl]pentyl] acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 163320742 |
| Molecular Formula | C31H38F3N5O13 |
| Molecular Weight | 745.66 g/mol |
| Exact Mass | 745.24 |
| IUPAC Name | [(2S,3R,4R)-2,3,4-triacetyloxy-5-[3-[2-(2-aminoethoxy)ethyl]-7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl]pentyl] acetate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](Cn1c2nc(=O)n(CCOCCN)c(=O)c-2nc2cc(C)c(C)cc21)OC(C)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H37N5O11.C2HF3O2/c1-15-11-21-22(12-16(15)2)34(27-25(31-21)28(39)33(29(40)32-27)8-10-41-9-7-30)13-23(43-18(4)36)26(45-20(6)38)24(44-19(5)37)14-42-17(3)35;3-2(4,5)1(6)7/h11-12,23-24,26H,7-10,13-14,30H2,1-6H3;(H,6,7)/t23-,24+,26-;/m1./s1 |
| InChIKey | ZJHJXXNRXBRPTJ-MFEYWNJFSA-N |
| XLogP | 0.64 |
| TPSA | 247.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.66 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|