C29H36N6O11 — CID 162770880
ethyl 3-[5-[6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentyl]quinoxalin-2-yl]tetrazol-1-yl]propanoate (PubChem CID 162770880) has the molecular formula C29H36N6O11 and a molecular weight of 644.64 g/mol. Its IUPAC name is ethyl 3-[5-[6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentyl]quinoxalin-2-yl]tetrazol-1-yl]propanoate.
| Compound Name | ethyl 3-[5-[6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentyl]quinoxalin-2-yl]tetrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 162770880 |
| Molecular Formula | C29H36N6O11 |
| Molecular Weight | 644.64 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | ethyl 3-[5-[6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentyl]quinoxalin-2-yl]tetrazol-1-yl]propanoate |
| SMILES | CCOC(=O)CCn1nnnc1-c1nc2cc(C)c(C)cc2n(C[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)c1=O |
| InChI | InChI=1S/C29H36N6O11/c1-8-42-25(40)9-10-35-28(31-32-33-35)26-29(41)34(22-12-16(3)15(2)11-21(22)30-26)13-23(44-18(5)37)27(46-20(7)39)24(45-19(6)38)14-43-17(4)36/h11-12,23-24,27H,8-10,13-14H2,1-7H3/t23-,24+,27-/m0/s1 |
| InChIKey | OSCACIXDMZJKQI-XFAFFCHDSA-N |
| XLogP | 0.98 |
| TPSA | 209.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.64 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|