C29H35BrN4O10 — CID 118077456
3-acetyl-3-[9-acetyl-3-(4-bromobutyl)-7-methyl-2,4-dioxo-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridin-8-yl]pentane-2,4-dione (PubChem CID 118077456) has the molecular formula C29H35BrN4O10 and a molecular weight of 679.52 g/mol. Its IUPAC name is 3-acetyl-3-[9-acetyl-3-(4-bromobutyl)-7-methyl-2,4-dioxo-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridin-8-yl]pentane-2,4-dione.
| Compound Name | 3-acetyl-3-[9-acetyl-3-(4-bromobutyl)-7-methyl-2,4-dioxo-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridin-8-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 118077456 |
| Molecular Formula | C29H35BrN4O10 |
| Molecular Weight | 679.52 g/mol |
| Exact Mass | 678.15 |
| IUPAC Name | 3-acetyl-3-[9-acetyl-3-(4-bromobutyl)-7-methyl-2,4-dioxo-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridin-8-yl]pentane-2,4-dione |
| SMILES | CC(=O)c1c(C(C(C)=O)(C(C)=O)C(C)=O)c(C)cc2nc3c(=O)n(CCCCBr)c(=O)nc-3n(C[C@@H](O)[C@@H](O)[C@@H](O)CO)c12 |
| InChI | InChI=1S/C29H35BrN4O10/c1-13-10-18-24(21(14(2)36)22(13)29(15(3)37,16(4)38)17(5)39)34(11-19(40)25(42)20(41)12-35)26-23(31-18)27(43)33(28(44)32-26)9-7-6-8-30/h10,19-20,25,35,40-42H,6-9,11-12H2,1-5H3/t19-,20+,25-/m1/s1 |
| InChIKey | UWSOBMNTIBMHHU-OHUGHZGNSA-N |
| XLogP | -0.18 |
| TPSA | 218.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.52 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|