C29H32N6O2+2 — CID 140726719
10-butyl-7,8-dimethyl-3-[3-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)propyl]benzo[g]pteridine-2,4-dione (PubChem CID 140726719) has the molecular formula C29H32N6O2+2 and a molecular weight of 496.62 g/mol. Its IUPAC name is 10-butyl-7,8-dimethyl-3-[3-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)propyl]benzo[g]pteridine-2,4-dione.
| Compound Name | 10-butyl-7,8-dimethyl-3-[3-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)propyl]benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 140726719 |
| Molecular Formula | C29H32N6O2+2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 10-butyl-7,8-dimethyl-3-[3-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)propyl]benzo[g]pteridine-2,4-dione |
| SMILES | CCCCn1c2nc(=O)n(CCC[n+]3ccc(-c4cc[nH+]cc4)cc3)c(=O)c-2nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C29H31N6O2/c1-4-5-14-34-25-19-21(3)20(2)18-24(25)31-26-27(34)32-29(37)35(28(26)36)15-6-13-33-16-9-23(10-17-33)22-7-11-30-12-8-22/h7-12,16-19H,4-6,13-15H2,1-3H3/q+1/p+1 |
| InChIKey | FYRQXBJHHKNAOE-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 87.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|