C30H34I2N6O2 — CID 157107350
10-butyl-7,8-dimethyl-3-[3-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]propyl]benzo[g]pteridine-2,4-dione diiodide (PubChem CID 157107350) has the molecular formula C30H34I2N6O2 and a molecular weight of 764.45 g/mol. Its IUPAC name is 10-butyl-7,8-dimethyl-3-[3-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]propyl]benzo[g]pteridine-2,4-dione diiodide.
| Compound Name | 10-butyl-7,8-dimethyl-3-[3-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]propyl]benzo[g]pteridine-2,4-dione diiodide |
|---|---|
| PubChem CID | 157107350 |
| Molecular Formula | C30H34I2N6O2 |
| Molecular Weight | 764.45 g/mol |
| Exact Mass | 764.08 |
| IUPAC Name | 10-butyl-7,8-dimethyl-3-[3-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]propyl]benzo[g]pteridine-2,4-dione diiodide |
| SMILES | CCCCn1c2nc(=O)n(CCC[n+]3ccc(-c4cc[n+](C)cc4)cc3)c(=O)c-2nc2cc(C)c(C)cc21.[I-].[I-] |
| InChI | InChI=1S/C30H34N6O2.2HI/c1-5-6-13-35-26-20-22(3)21(2)19-25(26)31-27-28(35)32-30(38)36(29(27)37)14-7-12-34-17-10-24(11-18-34)23-8-15-33(4)16-9-23;;/h8-11,15-20H,5-7,12-14H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | ULHHPHFLILOJJY-UHFFFAOYSA-L |
| XLogP | -2.65 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.45 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|