C21H31F3N2O — CID 145378448
ethane;4-[(Z)-1-[(2-methyl-1-pyrrolidin-2-ylbutylidene)amino]prop-1-enyl]-2-(trifluoromethyl)phenol (PubChem CID 145378448) has the molecular formula C21H31F3N2O and a molecular weight of 384.49 g/mol. Its IUPAC name is ethane;4-[(Z)-1-[(2-methyl-1-pyrrolidin-2-ylbutylidene)amino]prop-1-enyl]-2-(trifluoromethyl)phenol.
| Compound Name | ethane;4-[(Z)-1-[(2-methyl-1-pyrrolidin-2-ylbutylidene)amino]prop-1-enyl]-2-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 145378448 |
| Molecular Formula | C21H31F3N2O |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | ethane;4-[(Z)-1-[(2-methyl-1-pyrrolidin-2-ylbutylidene)amino]prop-1-enyl]-2-(trifluoromethyl)phenol |
| SMILES | C/C=C(\N=C(\C(C)CC)C1CCCN1)c1ccc(O)c(C(F)(F)F)c1.CC |
| InChI | InChI=1S/C19H25F3N2O.C2H6/c1-4-12(3)18(16-7-6-10-23-16)24-15(5-2)13-8-9-17(25)14(11-13)19(20,21)22;1-2/h5,8-9,11-12,16,23,25H,4,6-7,10H2,1-3H3;1-2H3/b15-5-,24-18-; |
| InChIKey | AGRRZSKUJQGBIU-CGFVBPHNSA-N |
| XLogP | 6.04 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|