C19H25F3N2O — CID 145378449
4-[(Z)-1-[(2-methyl-1-pyrrolidin-2-ylbutylidene)amino]prop-1-enyl]-2-(trifluoromethyl)phenol (PubChem CID 145378449) has the molecular formula C19H25F3N2O and a molecular weight of 354.42 g/mol. Its IUPAC name is 4-[(Z)-1-[(2-methyl-1-pyrrolidin-2-ylbutylidene)amino]prop-1-enyl]-2-(trifluoromethyl)phenol.
| Compound Name | 4-[(Z)-1-[(2-methyl-1-pyrrolidin-2-ylbutylidene)amino]prop-1-enyl]-2-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 145378449 |
| Molecular Formula | C19H25F3N2O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 4-[(Z)-1-[(2-methyl-1-pyrrolidin-2-ylbutylidene)amino]prop-1-enyl]-2-(trifluoromethyl)phenol |
| SMILES | C/C=C(\N=C(\C(C)CC)C1CCCN1)c1ccc(O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H25F3N2O/c1-4-12(3)18(16-7-6-10-23-16)24-15(5-2)13-8-9-17(25)14(11-13)19(20,21)22/h5,8-9,11-12,16,23,25H,4,6-7,10H2,1-3H3/b15-5-,24-18- |
| InChIKey | SOEHYBICMKKLHV-GXRUQZDUSA-N |
| XLogP | 5.01 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|