C25H31F2N3O3 — CID 145383235
methyl N-[1-[2-[[(2S)-1-[[5-(1,1-difluoropropyl)-2-pyridinyl]oxy]propan-2-yl]-ethylcarbamoyl]phenyl]ethenyl]ethanimidate (PubChem CID 145383235) has the molecular formula C25H31F2N3O3 and a molecular weight of 459.54 g/mol. Its IUPAC name is methyl N-[1-[2-[[(2S)-1-[[5-(1,1-difluoropropyl)-2-pyridinyl]oxy]propan-2-yl]-ethylcarbamoyl]phenyl]ethenyl]ethanimidate.
| Compound Name | methyl N-[1-[2-[[(2S)-1-[[5-(1,1-difluoropropyl)-2-pyridinyl]oxy]propan-2-yl]-ethylcarbamoyl]phenyl]ethenyl]ethanimidate |
|---|---|
| PubChem CID | 145383235 |
| Molecular Formula | C25H31F2N3O3 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | methyl N-[1-[2-[[(2S)-1-[[5-(1,1-difluoropropyl)-2-pyridinyl]oxy]propan-2-yl]-ethylcarbamoyl]phenyl]ethenyl]ethanimidate |
| SMILES | C=C(/N=C(\C)OC)c1ccccc1C(=O)N(CC)[C@@H](C)COc1ccc(C(F)(F)CC)cn1 |
| InChI | InChI=1S/C25H31F2N3O3/c1-7-25(26,27)20-13-14-23(28-15-20)33-16-17(3)30(8-2)24(31)22-12-10-9-11-21(22)18(4)29-19(5)32-6/h9-15,17H,4,7-8,16H2,1-3,5-6H3/b29-19+/t17-/m0/s1 |
| InChIKey | PLPDQIJIHXTXBZ-LOCKMVRZSA-N |
| XLogP | 5.55 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|