C18H18F4N2O2 — CID 146577195
N-ethyl-4-fluoro-N-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]benzamide (PubChem CID 146577195) has the molecular formula C18H18F4N2O2 and a molecular weight of 370.35 g/mol. Its IUPAC name is N-ethyl-4-fluoro-N-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]benzamide.
| Compound Name | N-ethyl-4-fluoro-N-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 146577195 |
| Molecular Formula | C18H18F4N2O2 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-ethyl-4-fluoro-N-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]benzamide |
| SMILES | CCN(C(=O)c1ccc(F)cc1)C(C)COc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H18F4N2O2/c1-3-24(17(25)13-4-7-15(19)8-5-13)12(2)11-26-16-9-6-14(10-23-16)18(20,21)22/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | AZYIVWUVCPALPP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |