C25H28F4N4O2 — CID 145383230
N-ethyl-2-fluoro-3-methyl-6-[methyl-[(Z)-pent-2-ynylideneamino]amino]-N-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]benzamide (PubChem CID 145383230) has the molecular formula C25H28F4N4O2 and a molecular weight of 492.52 g/mol. Its IUPAC name is N-ethyl-2-fluoro-3-methyl-6-[methyl-[(Z)-pent-2-ynylideneamino]amino]-N-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]benzamide.
| Compound Name | N-ethyl-2-fluoro-3-methyl-6-[methyl-[(Z)-pent-2-ynylideneamino]amino]-N-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 145383230 |
| Molecular Formula | C25H28F4N4O2 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | N-ethyl-2-fluoro-3-methyl-6-[methyl-[(Z)-pent-2-ynylideneamino]amino]-N-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]benzamide |
| SMILES | CCC#C/C=N\N(C)c1ccc(C)c(F)c1C(=O)N(CC)C(C)COc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C25H28F4N4O2/c1-6-8-9-14-31-32(5)20-12-10-17(3)23(26)22(20)24(34)33(7-2)18(4)16-35-21-13-11-19(15-30-21)25(27,28)29/h10-15,18H,6-7,16H2,1-5H3/b31-14- |
| InChIKey | RQZXHZXVAYHIID-AQLQTECXSA-N |
| XLogP | 5.31 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|