C24H29F2N5O2 — CID 146578935
N-[1-[5-(difluoromethyl)pyrazin-2-yl]oxypropan-2-yl]-N-ethyl-4-methyl-2-[methyl-[(Z)-pent-2-ynylideneamino]amino]benzamide (PubChem CID 146578935) has the molecular formula C24H29F2N5O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[1-[5-(difluoromethyl)pyrazin-2-yl]oxypropan-2-yl]-N-ethyl-4-methyl-2-[methyl-[(Z)-pent-2-ynylideneamino]amino]benzamide.
| Compound Name | N-[1-[5-(difluoromethyl)pyrazin-2-yl]oxypropan-2-yl]-N-ethyl-4-methyl-2-[methyl-[(Z)-pent-2-ynylideneamino]amino]benzamide |
|---|---|
| PubChem CID | 146578935 |
| Molecular Formula | C24H29F2N5O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[1-[5-(difluoromethyl)pyrazin-2-yl]oxypropan-2-yl]-N-ethyl-4-methyl-2-[methyl-[(Z)-pent-2-ynylideneamino]amino]benzamide |
| SMILES | CCC#C/C=N\N(C)c1cc(C)ccc1C(=O)N(CC)C(C)COc1cnc(C(F)F)cn1 |
| InChI | InChI=1S/C24H29F2N5O2/c1-6-8-9-12-29-30(5)21-13-17(3)10-11-19(21)24(32)31(7-2)18(4)16-33-22-15-27-20(14-28-22)23(25)26/h10-15,18,23H,6-7,16H2,1-5H3/b29-12- |
| InChIKey | ZEIJZZXGBVNZGD-ULPWCQAASA-N |
| XLogP | 4.49 |
| TPSA | 70.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|