C24H24F6N4O2 — CID 145383276
N-ethyl-3,4-difluoro-N-[1-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]-2-[methyl-[(Z)-pent-2-ynylideneamino]amino]benzamide (PubChem CID 145383276) has the molecular formula C24H24F6N4O2 and a molecular weight of 514.47 g/mol. Its IUPAC name is N-ethyl-3,4-difluoro-N-[1-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]-2-[methyl-[(Z)-pent-2-ynylideneamino]amino]benzamide.
| Compound Name | N-ethyl-3,4-difluoro-N-[1-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]-2-[methyl-[(Z)-pent-2-ynylideneamino]amino]benzamide |
|---|---|
| PubChem CID | 145383276 |
| Molecular Formula | C24H24F6N4O2 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | N-ethyl-3,4-difluoro-N-[1-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl]-2-[methyl-[(Z)-pent-2-ynylideneamino]amino]benzamide |
| SMILES | CCC#C/C=N\N(C)c1c(C(=O)N(CC)C(C)COc2ncc(C(F)(F)F)cc2F)ccc(F)c1F |
| InChI | InChI=1S/C24H24F6N4O2/c1-5-7-8-11-32-33(4)21-17(9-10-18(25)20(21)27)23(35)34(6-2)15(3)14-36-22-19(26)12-16(13-31-22)24(28,29)30/h9-13,15H,5-6,14H2,1-4H3/b32-11- |
| InChIKey | ZPBZAXUDTJEWNE-MDVINBTASA-N |
| XLogP | 5.28 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|