C26H34ClN3O3 — CID 146577971
1-[2-[[(2S)-1-[(5-chloro-2-pyridinyl)oxy]propan-2-yl]-ethylcarbamoyl]-5-methylphenyl]ethenyl N-[(2R)-butan-2-yl]ethanimidate (PubChem CID 146577971) has the molecular formula C26H34ClN3O3 and a molecular weight of 472.03 g/mol. Its IUPAC name is 1-[2-[[(2S)-1-[(5-chloro-2-pyridinyl)oxy]propan-2-yl]-ethylcarbamoyl]-5-methylphenyl]ethenyl N-[(2R)-butan-2-yl]ethanimidate.
| Compound Name | 1-[2-[[(2S)-1-[(5-chloro-2-pyridinyl)oxy]propan-2-yl]-ethylcarbamoyl]-5-methylphenyl]ethenyl N-[(2R)-butan-2-yl]ethanimidate |
|---|---|
| PubChem CID | 146577971 |
| Molecular Formula | C26H34ClN3O3 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 1-[2-[[(2S)-1-[(5-chloro-2-pyridinyl)oxy]propan-2-yl]-ethylcarbamoyl]-5-methylphenyl]ethenyl N-[(2R)-butan-2-yl]ethanimidate |
| SMILES | C=C(O/C(C)=N/[C@H](C)CC)c1cc(C)ccc1C(=O)N(CC)[C@@H](C)COc1ccc(Cl)cn1 |
| InChI | InChI=1S/C26H34ClN3O3/c1-8-18(4)29-21(7)33-20(6)24-14-17(3)10-12-23(24)26(31)30(9-2)19(5)16-32-25-13-11-22(27)15-28-25/h10-15,18-19H,6,8-9,16H2,1-5,7H3/b29-21+/t18-,19+/m1/s1 |
| InChIKey | VDKXMHRQHAOXQZ-NUMBFPJMSA-N |
| XLogP | 6.18 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|