C15H26N4O — CID 145384939
N'-[2-(aminomethylideneamino)ethyl]-4-propoxybenzenecarboximidamide;ethane (PubChem CID 145384939) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is N'-[2-(aminomethylideneamino)ethyl]-4-propoxybenzenecarboximidamide;ethane.
| Compound Name | N'-[2-(aminomethylideneamino)ethyl]-4-propoxybenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 145384939 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N'-[2-(aminomethylideneamino)ethyl]-4-propoxybenzenecarboximidamide;ethane |
| SMILES | CC.CCCOc1ccc(/C(N)=N/CC/N=C/N)cc1 |
| InChI | InChI=1S/C13H20N4O.C2H6/c1-2-9-18-12-5-3-11(4-6-12)13(15)17-8-7-16-10-14;1-2/h3-6,10H,2,7-9H2,1H3,(H2,14,16)(H2,15,17);1-2H3 |
| InChIKey | ZBZXLSRTBRCWJN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|