C24H37N5O2 — CID 145385512
4-[(2S)-1,2-dimethylpiperidin-4-yl]-6-methoxy-N-methyl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-2-amine (PubChem CID 145385512) has the molecular formula C24H37N5O2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-[(2S)-1,2-dimethylpiperidin-4-yl]-6-methoxy-N-methyl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-2-amine.
| Compound Name | 4-[(2S)-1,2-dimethylpiperidin-4-yl]-6-methoxy-N-methyl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-2-amine |
|---|---|
| PubChem CID | 145385512 |
| Molecular Formula | C24H37N5O2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 4-[(2S)-1,2-dimethylpiperidin-4-yl]-6-methoxy-N-methyl-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-2-amine |
| SMILES | CNc1nc(C2CCN(C)[C@@H](C)C2)c2cc(OC)c(OCCCN3CCCC3)cc2n1 |
| InChI | InChI=1S/C24H37N5O2/c1-17-14-18(8-12-28(17)3)23-19-15-21(30-4)22(16-20(19)26-24(25-2)27-23)31-13-7-11-29-9-5-6-10-29/h15-18H,5-14H2,1-4H3,(H,25,26,27)/t17-,18?/m0/s1 |
| InChIKey | PKHZEQUVCRSLLZ-ZENAZSQFSA-N |
| XLogP | 3.74 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|