About 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen
2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen (PubChem CID 145388877) has the molecular formula C7H20N2OS
and a molecular weight of 180.32 g/mol. Its IUPAC name is 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen.
Molecular Properties
| Compound Name | 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen |
| PubChem CID | 145388877 |
| Molecular Formula | C7H20N2OS |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen |
| SMILES | CCN(C)CCN=S(C)(C)=O.[H][H] |
| InChI | InChI=1S/C7H18N2OS.H2/c1-5-9(2)7-6-8-11(3,4)10;/h5-7H2,1-4H3;1H |
| InChIKey | JSBUGKCIWYNCHN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen?
The IUPAC name of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen (CID 145388877) is 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen.
What is the SMILES notation for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen?
The canonical SMILES for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen is CCN(C)CCN=S(C)(C)=O.[H][H].
What is the InChIKey of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen?
The InChIKey is JSBUGKCIWYNCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2OS.H2/c1-5-9(2)7-6-8-11(3,4)10;/h5-7H2,1-4H3;1H.
What are the key properties of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen?
2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen has a molecular weight of 180.32 g/mol, XLogP of 0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-ethyl-N-methylethanamine;molecular hydrogen is sourced from PubChem (CID 145388877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).