C37H30FNO2 — CID 145389647
1-[6-[4-[2-[4-(2-fluoro-4-propylphenyl)phenyl]ethyl]phenyl]naphthalen-2-yl]pyrrole-2,5-dione (PubChem CID 145389647) has the molecular formula C37H30FNO2 and a molecular weight of 539.65 g/mol. Its IUPAC name is 1-[6-[4-[2-[4-(2-fluoro-4-propylphenyl)phenyl]ethyl]phenyl]naphthalen-2-yl]pyrrole-2,5-dione.
| Compound Name | 1-[6-[4-[2-[4-(2-fluoro-4-propylphenyl)phenyl]ethyl]phenyl]naphthalen-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 145389647 |
| Molecular Formula | C37H30FNO2 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 1-[6-[4-[2-[4-(2-fluoro-4-propylphenyl)phenyl]ethyl]phenyl]naphthalen-2-yl]pyrrole-2,5-dione |
| SMILES | CCCc1ccc(-c2ccc(CCc3ccc(-c4ccc5cc(N6C(=O)C=CC6=O)ccc5c4)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C37H30FNO2/c1-2-3-27-10-19-34(35(38)22-27)29-13-8-26(9-14-29)5-4-25-6-11-28(12-7-25)30-15-16-32-24-33(18-17-31(32)23-30)39-36(40)20-21-37(39)41/h6-24H,2-5H2,1H3 |
| InChIKey | XTLOKLIUVFVCEB-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|