C30H27FN4O3 — CID 145391235
(5E)-N-(4-fluorophenyl)-5-hydroxyimino-2-(2-phenoxyethylamino)-7-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide (PubChem CID 145391235) has the molecular formula C30H27FN4O3 and a molecular weight of 510.57 g/mol. Its IUPAC name is (5E)-N-(4-fluorophenyl)-5-hydroxyimino-2-(2-phenoxyethylamino)-7-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide.
| Compound Name | (5E)-N-(4-fluorophenyl)-5-hydroxyimino-2-(2-phenoxyethylamino)-7-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 145391235 |
| Molecular Formula | C30H27FN4O3 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (5E)-N-(4-fluorophenyl)-5-hydroxyimino-2-(2-phenoxyethylamino)-7-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc2c(nc1NCCOc1ccccc1)CC(c1ccccc1)C/C2=N\O |
| InChI | InChI=1S/C30H27FN4O3/c31-22-11-13-23(14-12-22)33-30(36)26-19-25-27(17-21(18-28(25)35-37)20-7-3-1-4-8-20)34-29(26)32-15-16-38-24-9-5-2-6-10-24/h1-14,19,21,37H,15-18H2,(H,32,34)(H,33,36)/b35-28+ |
| InChIKey | DOSDZXFTUKJLNT-AWQADKOQSA-N |
| XLogP | 5.87 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|