C30H29FN4O3 — CID 145391384
(5E)-N-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]-5-hydroxyimino-2-(2-phenoxyethylamino)-7-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide (PubChem CID 145391384) has the molecular formula C30H29FN4O3 and a molecular weight of 512.59 g/mol. Its IUPAC name is (5E)-N-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]-5-hydroxyimino-2-(2-phenoxyethylamino)-7-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide.
| Compound Name | (5E)-N-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]-5-hydroxyimino-2-(2-phenoxyethylamino)-7-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 145391384 |
| Molecular Formula | C30H29FN4O3 |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (5E)-N-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]-5-hydroxyimino-2-(2-phenoxyethylamino)-7-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide |
| SMILES | C=C/C(F)=C\C=C\NC(=O)c1cc2c(nc1NCCOc1ccccc1)CC(c1ccccc1)C/C2=N\O |
| InChI | InChI=1S/C30H29FN4O3/c1-2-23(31)12-9-15-33-30(36)26-20-25-27(18-22(19-28(25)35-37)21-10-5-3-6-11-21)34-29(26)32-16-17-38-24-13-7-4-8-14-24/h2-15,20,22,37H,1,16-19H2,(H,32,34)(H,33,36)/b15-9+,23-12+,35-28+ |
| InChIKey | JJLQMBHXCIJRQX-IRYSUTHESA-N |
| XLogP | 5.76 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|