C16H17ClN2S — CID 145392518
6-[(E)-1-[(E)-1-chloroprop-1-enyl]sulfanylprop-1-enyl]-N-methylisoquinolin-3-amine (PubChem CID 145392518) has the molecular formula C16H17ClN2S and a molecular weight of 304.85 g/mol. Its IUPAC name is 6-[(E)-1-[(E)-1-chloroprop-1-enyl]sulfanylprop-1-enyl]-N-methylisoquinolin-3-amine.
| Compound Name | 6-[(E)-1-[(E)-1-chloroprop-1-enyl]sulfanylprop-1-enyl]-N-methylisoquinolin-3-amine |
|---|---|
| PubChem CID | 145392518 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 6-[(E)-1-[(E)-1-chloroprop-1-enyl]sulfanylprop-1-enyl]-N-methylisoquinolin-3-amine |
| SMILES | C/C=C(/Cl)S/C(=C/C)c1ccc2cnc(NC)cc2c1 |
| InChI | InChI=1S/C16H17ClN2S/c1-4-14(20-15(17)5-2)11-6-7-12-10-19-16(18-3)9-13(12)8-11/h4-10H,1-3H3,(H,18,19)/b14-4+,15-5- |
| InChIKey | VVNVRERQHHDAOU-SLLPJLPKSA-N |
| XLogP | 5.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |