C20H30N2O4 — CID 145392999
methane;5-(2-methylphenyl)imino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid (PubChem CID 145392999) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is methane;5-(2-methylphenyl)imino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid.
| Compound Name | methane;5-(2-methylphenyl)imino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid |
|---|---|
| PubChem CID | 145392999 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | methane;5-(2-methylphenyl)imino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-6-enoic acid |
| SMILES | C.C=C/C(CCC(NC(=O)OC(C)(C)C)C(=O)O)=N\c1ccccc1C |
| InChI | InChI=1S/C19H26N2O4.CH4/c1-6-14(20-15-10-8-7-9-13(15)2)11-12-16(17(22)23)21-18(24)25-19(3,4)5;/h6-10,16H,1,11-12H2,2-5H3,(H,21,24)(H,22,23);1H4/b20-14+; |
| InChIKey | DPSHISFNRWWDAA-RANVTSCRSA-N |
| XLogP | 4.65 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|