C16H22N2O6 — CID 70083694
(3S)-4-(2-hydroxyphenyl)imino-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 70083694) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is (3S)-4-(2-hydroxyphenyl)imino-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (3S)-4-(2-hydroxyphenyl)imino-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 70083694 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (3S)-4-(2-hydroxyphenyl)imino-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CO/C(=N\c1ccccc1O)[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22N2O6/c1-16(2,3)24-15(22)18-11(9-13(20)21)14(23-4)17-10-7-5-6-8-12(10)19/h5-8,11,19H,9H2,1-4H3,(H,18,22)(H,20,21)/b17-14-/t11-/m0/s1 |
| InChIKey | RQLCBLZGHQEZCD-KFZGLNKMSA-N |
| XLogP | 2.44 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|