C32H36N2O8 — CID 70142945
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxy-4-[(1S)-1-phenyl-2-phenylmethoxycarbonyloxyethyl]iminobutanoic acid (PubChem CID 70142945) has the molecular formula C32H36N2O8 and a molecular weight of 576.65 g/mol. Its IUPAC name is (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxy-4-[(1S)-1-phenyl-2-phenylmethoxycarbonyloxyethyl]iminobutanoic acid.
| Compound Name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxy-4-[(1S)-1-phenyl-2-phenylmethoxycarbonyloxyethyl]iminobutanoic acid |
|---|---|
| PubChem CID | 70142945 |
| Molecular Formula | C32H36N2O8 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxy-4-[(1S)-1-phenyl-2-phenylmethoxycarbonyloxyethyl]iminobutanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)/C(=N/[C@H](COC(=O)OCc1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H36N2O8/c1-32(2,3)42-30(37)34-26(19-28(35)36)29(39-20-23-13-7-4-8-14-23)33-27(25-17-11-6-12-18-25)22-41-31(38)40-21-24-15-9-5-10-16-24/h4-18,26-27H,19-22H2,1-3H3,(H,34,37)(H,35,36)/b33-29-/t26-,27-/m1/s1 |
| InChIKey | SOHKQNYZINNQGR-UJPKDGBOSA-N |
| XLogP | 6.06 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|