C14H22N2 — CID 145394721
ethane;1-methyl-3-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]pyrazole (PubChem CID 145394721) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is ethane;1-methyl-3-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]pyrazole.
| Compound Name | ethane;1-methyl-3-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]pyrazole |
|---|---|
| PubChem CID | 145394721 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | ethane;1-methyl-3-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]pyrazole |
| SMILES | C=C(/C=C\C(=C)c1ccn(C)n1)CC.CC |
| InChI | InChI=1S/C12H16N2.C2H6/c1-5-10(2)6-7-11(3)12-8-9-14(4)13-12;1-2/h6-9H,2-3,5H2,1,4H3;1-2H3/b7-6-; |
| InChIKey | SMNZOBNHPMJTDD-NAFXZHHSSA-N |
| XLogP | 3.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|