About ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile
ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile (PubChem CID 145394880) has the molecular formula C25H34N2
and a molecular weight of 362.56 g/mol. Its IUPAC name is ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile.
Molecular Properties
| Compound Name | ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile |
| PubChem CID | 145394880 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile |
| SMILES | C=C.CC.CC1(CC#N)CCC(Nc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H24N2.C2H6.C2H4/c1-21(15-16-22)13-11-20(12-14-21)23-19-9-7-18(8-10-19)17-5-3-2-4-6-17;2*1-2/h2-10,20,23H,11-15H2,1H3;1-2H3;1-2H2 |
| InChIKey | FSGAKKQYLIKDNM-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile?
The IUPAC name of ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile (CID 145394880) is ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile.
What is the SMILES notation for ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile?
The canonical SMILES for ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile is C=C.CC.CC1(CC#N)CCC(Nc2ccc(-c3ccccc3)cc2)CC1.
What is the InChIKey of ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile?
The InChIKey is FSGAKKQYLIKDNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2.C2H6.C2H4/c1-21(15-16-22)13-11-20(12-14-21)23-19-9-7-18(8-10-19)17-5-3-2-4-6-17;2*1-2/h2-10,20,23H,11-15H2,1H3;1-2H3;1-2H2.
What are the key properties of ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile?
ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile has a molecular weight of 362.56 g/mol, XLogP of 7.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;2-[1-methyl-4-(4-phenylanilino)cyclohexyl]acetonitrile is sourced from PubChem (CID 145394880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).