C24H33F3N2 — CID 145395219
ethane;2-[4-methyl-1-[(3Z,7E)-2,5,6-trimethylidene-8-(trifluoromethyl)deca-3,7,9-trienyl]piperidin-4-yl]acetonitrile (PubChem CID 145395219) has the molecular formula C24H33F3N2 and a molecular weight of 406.54 g/mol. Its IUPAC name is ethane;2-[4-methyl-1-[(3Z,7E)-2,5,6-trimethylidene-8-(trifluoromethyl)deca-3,7,9-trienyl]piperidin-4-yl]acetonitrile.
| Compound Name | ethane;2-[4-methyl-1-[(3Z,7E)-2,5,6-trimethylidene-8-(trifluoromethyl)deca-3,7,9-trienyl]piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 145395219 |
| Molecular Formula | C24H33F3N2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | ethane;2-[4-methyl-1-[(3Z,7E)-2,5,6-trimethylidene-8-(trifluoromethyl)deca-3,7,9-trienyl]piperidin-4-yl]acetonitrile |
| SMILES | C=C/C(=C\C(=C)C(=C)/C=C\C(=C)CN1CCC(C)(CC#N)CC1)C(F)(F)F.CC |
| InChI | InChI=1S/C22H27F3N2.C2H6/c1-6-20(22(23,24)25)15-19(4)18(3)8-7-17(2)16-27-13-10-21(5,9-12-26)11-14-27;1-2/h6-8,15H,1-4,9-11,13-14,16H2,5H3;1-2H3/b8-7-,20-15+; |
| InChIKey | RDMYOWNAESOCQJ-JNEBPEKESA-N |
| XLogP | 6.93 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|