C9H18N2O2S — CID 145396418
ethane;N-methyl-2-(3-oxothiomorpholin-2-yl)acetamide (PubChem CID 145396418) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is ethane;N-methyl-2-(3-oxothiomorpholin-2-yl)acetamide.
| Compound Name | ethane;N-methyl-2-(3-oxothiomorpholin-2-yl)acetamide |
|---|---|
| PubChem CID | 145396418 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | ethane;N-methyl-2-(3-oxothiomorpholin-2-yl)acetamide |
| SMILES | CC.CNC(=O)CC1SCCNC1=O |
| InChI | InChI=1S/C7H12N2O2S.C2H6/c1-8-6(10)4-5-7(11)9-2-3-12-5;1-2/h5H,2-4H2,1H3,(H,8,10)(H,9,11);1-2H3 |
| InChIKey | KQUSLUHYUWIKRT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |