C12H13FN2O2S — CID 6458087
N-(2-fluorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide (PubChem CID 6458087) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide.
| Compound Name | N-(2-fluorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide |
|---|---|
| PubChem CID | 6458087 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(2-fluorophenyl)-2-(3-oxothiomorpholin-2-yl)acetamide |
| SMILES | O=C(CC1SCCNC1=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H13FN2O2S/c13-8-3-1-2-4-9(8)15-11(16)7-10-12(17)14-5-6-18-10/h1-4,10H,5-7H2,(H,14,17)(H,15,16) |
| InChIKey | HHCOIUGMTUBQBU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |