C13H15FN2O3S — CID 162653892
N-(3-fluoro-4-methoxyphenyl)-2-(3-oxothiomorpholin-2-yl)acetamide (PubChem CID 162653892) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-2-(3-oxothiomorpholin-2-yl)acetamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-2-(3-oxothiomorpholin-2-yl)acetamide |
|---|---|
| PubChem CID | 162653892 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-2-(3-oxothiomorpholin-2-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2SCCNC2=O)cc1F |
| InChI | InChI=1S/C13H15FN2O3S/c1-19-10-3-2-8(6-9(10)14)16-12(17)7-11-13(18)15-4-5-20-11/h2-3,6,11H,4-5,7H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | OEEHRHHPDCRGCF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |