C26H27ClN6O5S — CID 145397206
N-[1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfanyl-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-amine (PubChem CID 145397206) has the molecular formula C26H27ClN6O5S and a molecular weight of 571.06 g/mol. Its IUPAC name is N-[1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfanyl-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-amine.
| Compound Name | N-[1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfanyl-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 145397206 |
| Molecular Formula | C26H27ClN6O5S |
| Molecular Weight | 571.06 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | N-[1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfanyl-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSC(C)C(OC)c2ncc(Cl)cn2)nnc1C1COc2ccccc2O1 |
| InChI | InChI=1S/C26H27ClN6O5S/c1-15(23(36-4)24-28-12-16(27)13-29-24)39-32-26-31-30-25(21-14-37-17-8-5-6-9-18(17)38-21)33(26)22-19(34-2)10-7-11-20(22)35-3/h5-13,15,21,23H,14H2,1-4H3,(H,31,32) |
| InChIKey | ILBUWGJXJXCGHU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.06 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|