C22H25ClN6O3S — CID 155052163
2-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-(3,6-dihydro-2H-pyran-3-yl)-1,2,4-triazol-4-yl]-3-methoxyphenol (PubChem CID 155052163) has the molecular formula C22H25ClN6O3S and a molecular weight of 489.00 g/mol. Its IUPAC name is 2-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-(3,6-dihydro-2H-pyran-3-yl)-1,2,4-triazol-4-yl]-3-methoxyphenol.
| Compound Name | 2-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-(3,6-dihydro-2H-pyran-3-yl)-1,2,4-triazol-4-yl]-3-methoxyphenol |
|---|---|
| PubChem CID | 155052163 |
| Molecular Formula | C22H25ClN6O3S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-(3,6-dihydro-2H-pyran-3-yl)-1,2,4-triazol-4-yl]-3-methoxyphenol |
| SMILES | COc1cccc(O)c1-n1c(NSC(C)C(C)c2ncc(Cl)cn2)nnc1C1C=CCOC1 |
| InChI | InChI=1S/C22H25ClN6O3S/c1-13(20-24-10-16(23)11-25-20)14(2)33-28-22-27-26-21(15-6-5-9-32-12-15)29(22)19-17(30)7-4-8-18(19)31-3/h4-8,10-11,13-15,30H,9,12H2,1-3H3,(H,27,28) |
| InChIKey | JLXLJNSMADEUTQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|