C23H30N6O3S — CID 155052164
4-(2,6-dimethoxyphenyl)-N-[3-(5-methylpyrimidin-2-yl)butan-2-ylsulfanyl]-5-(oxolan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 155052164) has the molecular formula C23H30N6O3S and a molecular weight of 470.60 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[3-(5-methylpyrimidin-2-yl)butan-2-ylsulfanyl]-5-(oxolan-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[3-(5-methylpyrimidin-2-yl)butan-2-ylsulfanyl]-5-(oxolan-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 155052164 |
| Molecular Formula | C23H30N6O3S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[3-(5-methylpyrimidin-2-yl)butan-2-ylsulfanyl]-5-(oxolan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSC(C)C(C)c2ncc(C)cn2)nnc1C1CCCO1 |
| InChI | InChI=1S/C23H30N6O3S/c1-14-12-24-21(25-13-14)15(2)16(3)33-28-23-27-26-22(19-10-7-11-32-19)29(23)20-17(30-4)8-6-9-18(20)31-5/h6,8-9,12-13,15-16,19H,7,10-11H2,1-5H3,(H,27,28) |
| InChIKey | UTPDHZVJDTYFBC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|