C21H24ClN7O3S — CID 145397254
5-[5-[1-(5-chloropyrimidin-2-yl)propan-2-ylsulfanylamino]-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-yl]pyrrolidin-2-one (PubChem CID 145397254) has the molecular formula C21H24ClN7O3S and a molecular weight of 489.99 g/mol. Its IUPAC name is 5-[5-[1-(5-chloropyrimidin-2-yl)propan-2-ylsulfanylamino]-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-yl]pyrrolidin-2-one.
| Compound Name | 5-[5-[1-(5-chloropyrimidin-2-yl)propan-2-ylsulfanylamino]-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 145397254 |
| Molecular Formula | C21H24ClN7O3S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 5-[5-[1-(5-chloropyrimidin-2-yl)propan-2-ylsulfanylamino]-4-(2,6-dimethoxyphenyl)-1,2,4-triazol-3-yl]pyrrolidin-2-one |
| SMILES | COc1cccc(OC)c1-n1c(NSC(C)Cc2ncc(Cl)cn2)nnc1C1CCC(=O)N1 |
| InChI | InChI=1S/C21H24ClN7O3S/c1-12(9-17-23-10-13(22)11-24-17)33-28-21-27-26-20(14-7-8-18(30)25-14)29(21)19-15(31-2)5-4-6-16(19)32-3/h4-6,10-12,14H,7-9H2,1-3H3,(H,25,30)(H,27,28) |
| InChIKey | ZFQIFPCAXSVKQG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|