C18H19N5O2 — CID 145397671
molecular hydrogen;2,4,8-trimethyl-N-[4-(1,3-oxazol-4-yl)phenyl]-1,5,8-triazabicyclo[4.2.0]octa-2,4,6-triene-7-carboxamide (PubChem CID 145397671) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is molecular hydrogen;2,4,8-trimethyl-N-[4-(1,3-oxazol-4-yl)phenyl]-1,5,8-triazabicyclo[4.2.0]octa-2,4,6-triene-7-carboxamide.
| Compound Name | molecular hydrogen;2,4,8-trimethyl-N-[4-(1,3-oxazol-4-yl)phenyl]-1,5,8-triazabicyclo[4.2.0]octa-2,4,6-triene-7-carboxamide |
|---|---|
| PubChem CID | 145397671 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | molecular hydrogen;2,4,8-trimethyl-N-[4-(1,3-oxazol-4-yl)phenyl]-1,5,8-triazabicyclo[4.2.0]octa-2,4,6-triene-7-carboxamide |
| SMILES | Cc1cc(C)n2c(n1)c(C(=O)Nc1ccc(-c3cocn3)cc1)n2C.[H][H] |
| InChI | InChI=1S/C18H17N5O2.H2/c1-11-8-12(2)23-17(20-11)16(22(23)3)18(24)21-14-6-4-13(5-7-14)15-9-25-10-19-15;/h4-10H,1-3H3,(H,21,24);1H |
| InChIKey | DAUUVHGLHMXZTH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |