C20H15N3O4 — CID 30823773
2-methyl-N-[4-(2-methyl-1,3-oxazol-4-yl)phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 30823773) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-methyl-N-[4-(2-methyl-1,3-oxazol-4-yl)phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-methyl-N-[4-(2-methyl-1,3-oxazol-4-yl)phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 30823773 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-methyl-N-[4-(2-methyl-1,3-oxazol-4-yl)phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)c3ccc4c(c3)C(=O)N(C)C4=O)cc2)co1 |
| InChI | InChI=1S/C20H15N3O4/c1-11-21-17(10-27-11)12-3-6-14(7-4-12)22-18(24)13-5-8-15-16(9-13)20(26)23(2)19(15)25/h3-10H,1-2H3,(H,22,24) |
| InChIKey | ULZFAEPQCSLJHT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|