C22H14F3N3O5 — CID 55782313
N-[4-(furan-3-carbonylamino)-2-(trifluoromethyl)phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55782313) has the molecular formula C22H14F3N3O5 and a molecular weight of 457.36 g/mol. Its IUPAC name is N-[4-(furan-3-carbonylamino)-2-(trifluoromethyl)phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-(furan-3-carbonylamino)-2-(trifluoromethyl)phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55782313 |
| Molecular Formula | C22H14F3N3O5 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-[4-(furan-3-carbonylamino)-2-(trifluoromethyl)phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)Nc3ccc(NC(=O)c4ccoc4)cc3C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C22H14F3N3O5/c1-28-20(31)14-4-2-11(8-15(14)21(28)32)18(29)27-17-5-3-13(9-16(17)22(23,24)25)26-19(30)12-6-7-33-10-12/h2-10H,1H3,(H,26,30)(H,27,29) |
| InChIKey | YWQGYRIGBXPPAM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|