C19H12F4N2O3 — CID 55782156
N-[4-[(3-fluorobenzoyl)amino]-3-(trifluoromethyl)phenyl]furan-3-carboxamide (PubChem CID 55782156) has the molecular formula C19H12F4N2O3 and a molecular weight of 392.31 g/mol. Its IUPAC name is N-[4-[(3-fluorobenzoyl)amino]-3-(trifluoromethyl)phenyl]furan-3-carboxamide.
| Compound Name | N-[4-[(3-fluorobenzoyl)amino]-3-(trifluoromethyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 55782156 |
| Molecular Formula | C19H12F4N2O3 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-[4-[(3-fluorobenzoyl)amino]-3-(trifluoromethyl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2cccc(F)c2)c(C(F)(F)F)c1)c1ccoc1 |
| InChI | InChI=1S/C19H12F4N2O3/c20-13-3-1-2-11(8-13)17(26)25-16-5-4-14(9-15(16)19(21,22)23)24-18(27)12-6-7-28-10-12/h1-10H,(H,24,27)(H,25,26) |
| InChIKey | GLALPWGARRDDHW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |