C23H18F3N3O3 — CID 55781872
N-[4-[[2-(2-methylindol-1-yl)acetyl]amino]-3-(trifluoromethyl)phenyl]furan-3-carboxamide (PubChem CID 55781872) has the molecular formula C23H18F3N3O3 and a molecular weight of 441.41 g/mol. Its IUPAC name is N-[4-[[2-(2-methylindol-1-yl)acetyl]amino]-3-(trifluoromethyl)phenyl]furan-3-carboxamide.
| Compound Name | N-[4-[[2-(2-methylindol-1-yl)acetyl]amino]-3-(trifluoromethyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 55781872 |
| Molecular Formula | C23H18F3N3O3 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[4-[[2-(2-methylindol-1-yl)acetyl]amino]-3-(trifluoromethyl)phenyl]furan-3-carboxamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)Nc1ccc(NC(=O)c2ccoc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H18F3N3O3/c1-14-10-15-4-2-3-5-20(15)29(14)12-21(30)28-19-7-6-17(11-18(19)23(24,25)26)27-22(31)16-8-9-32-13-16/h2-11,13H,12H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | AWHAONKICMBDHN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |