C19H24O6 — CID 145400904
5-[(4-cyclopentyloxy-3-methoxycyclohexa-1,3-dien-1-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 145400904) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-[(4-cyclopentyloxy-3-methoxycyclohexa-1,3-dien-1-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-cyclopentyloxy-3-methoxycyclohexa-1,3-dien-1-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 145400904 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-[(4-cyclopentyloxy-3-methoxycyclohexa-1,3-dien-1-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COC1=C(OC2CCCC2)CCC(C=C2C(=O)OC(C)(C)OC2=O)=C1 |
| InChI | InChI=1S/C19H24O6/c1-19(2)24-17(20)14(18(21)25-19)10-12-8-9-15(16(11-12)22-3)23-13-6-4-5-7-13/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | WFVKGUWNUFRINV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|