C33H36N4O5 — CID 145401634
3-naphthalen-1-yl-N-[2-oxo-2-[[(E)-5-oxo-1-(2-oxopiperidin-3-yl)pent-3-en-2-yl]amino]ethyl]-2-[(2-phenylacetyl)amino]propanamide (PubChem CID 145401634) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is 3-naphthalen-1-yl-N-[2-oxo-2-[[(E)-5-oxo-1-(2-oxopiperidin-3-yl)pent-3-en-2-yl]amino]ethyl]-2-[(2-phenylacetyl)amino]propanamide.
| Compound Name | 3-naphthalen-1-yl-N-[2-oxo-2-[[(E)-5-oxo-1-(2-oxopiperidin-3-yl)pent-3-en-2-yl]amino]ethyl]-2-[(2-phenylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 145401634 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 3-naphthalen-1-yl-N-[2-oxo-2-[[(E)-5-oxo-1-(2-oxopiperidin-3-yl)pent-3-en-2-yl]amino]ethyl]-2-[(2-phenylacetyl)amino]propanamide |
| SMILES | O=C/C=C/C(CC1CCCNC1=O)NC(=O)CNC(=O)C(Cc1cccc2ccccc12)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C33H36N4O5/c38-18-8-15-27(20-26-14-7-17-34-32(26)41)36-31(40)22-35-33(42)29(37-30(39)19-23-9-2-1-3-10-23)21-25-13-6-12-24-11-4-5-16-28(24)25/h1-6,8-13,15-16,18,26-27,29H,7,14,17,19-22H2,(H,34,41)(H,35,42)(H,36,40)(H,37,39)/b15-8+ |
| InChIKey | BMHJSBJJTXZKIC-OVCLIPMQSA-N |
| XLogP | 2.38 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|