C36H42N4O7 — CID 167481035
methyl (2S)-2-[[(2S)-3-cyclopropyl-2-[[(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoate (PubChem CID 167481035) has the molecular formula C36H42N4O7 and a molecular weight of 642.75 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-3-cyclopropyl-2-[[(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-3-cyclopropyl-2-[[(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 167481035 |
| Molecular Formula | C36H42N4O7 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | methyl (2S)-2-[[(2S)-3-cyclopropyl-2-[[(2S)-3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoate |
| SMILES | COC(=O)[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H](CC1CC1)NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H42N4O7/c1-46-35(44)31(21-27-14-8-18-37-32(27)41)39-33(42)29(19-23-16-17-23)38-34(43)30(40-36(45)47-22-24-9-3-2-4-10-24)20-26-13-7-12-25-11-5-6-15-28(25)26/h2-7,9-13,15,23,27,29-31H,8,14,16-22H2,1H3,(H,37,41)(H,38,43)(H,39,42)(H,40,45)/t27-,29-,30-,31-/m0/s1 |
| InChIKey | SWYOETIRWUTPPD-QBCKSJLUSA-N |
| XLogP | 3.54 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |