C38H40N4O7 — CID 146421438
2-[[2-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoic acid (PubChem CID 146421438) has the molecular formula C38H40N4O7 and a molecular weight of 664.76 g/mol. Its IUPAC name is 2-[[2-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoic acid.
| Compound Name | 2-[[2-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 146421438 |
| Molecular Formula | C38H40N4O7 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | 2-[[2-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoic acid |
| SMILES | O=C(NC(Cc1cccc2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)NC(C[C@@H]1CCCNC1=O)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C38H40N4O7/c43-34-29(18-10-20-39-34)23-33(37(46)47)41-35(44)31(21-25-11-3-1-4-12-25)40-36(45)32(42-38(48)49-24-26-13-5-2-6-14-26)22-28-17-9-16-27-15-7-8-19-30(27)28/h1-9,11-17,19,29,31-33H,10,18,20-24H2,(H,39,43)(H,40,45)(H,41,44)(H,42,48)(H,46,47)/t29-,31?,32?,33?/m0/s1 |
| InChIKey | PSFOFFDNHURLRQ-HLQXLZFKSA-N |
| XLogP | 3.89 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |