C25H26BBr3N2O7 — CID 145402791
2-[2-[(1R)-3-methyl-1-[[(2S)-3-phenyl-2-[(2,3,6-tribromobenzoyl)amino]propanoyl]amino]butyl]-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid (PubChem CID 145402791) has the molecular formula C25H26BBr3N2O7 and a molecular weight of 717.01 g/mol. Its IUPAC name is 2-[2-[(1R)-3-methyl-1-[[(2S)-3-phenyl-2-[(2,3,6-tribromobenzoyl)amino]propanoyl]amino]butyl]-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid.
| Compound Name | 2-[2-[(1R)-3-methyl-1-[[(2S)-3-phenyl-2-[(2,3,6-tribromobenzoyl)amino]propanoyl]amino]butyl]-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 145402791 |
| Molecular Formula | C25H26BBr3N2O7 |
| Molecular Weight | 717.01 g/mol |
| Exact Mass | 713.94 |
| IUPAC Name | 2-[2-[(1R)-3-methyl-1-[[(2S)-3-phenyl-2-[(2,3,6-tribromobenzoyl)amino]propanoyl]amino]butyl]-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1c(Br)ccc(Br)c1Br)B1OC(=O)C(CC(=O)O)O1 |
| InChI | InChI=1S/C25H26BBr3N2O7/c1-13(2)10-19(26-37-18(12-20(32)33)25(36)38-26)31-23(34)17(11-14-6-4-3-5-7-14)30-24(35)21-15(27)8-9-16(28)22(21)29/h3-9,13,17-19H,10-12H2,1-2H3,(H,30,35)(H,31,34)(H,32,33)/t17-,18?,19-/m0/s1 |
| InChIKey | DMPCRVNKUAQRPK-JVUMBYKBSA-N |
| XLogP | 4.29 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.01 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|