C14H19Cl2NO4 — CID 145402892
tert-butyl N-(2-chloro-6-chlorooxy-5-ethyl-3-methoxyphenyl)carbamate (PubChem CID 145402892) has the molecular formula C14H19Cl2NO4 and a molecular weight of 336.22 g/mol. Its IUPAC name is tert-butyl N-(2-chloro-6-chlorooxy-5-ethyl-3-methoxyphenyl)carbamate.
| Compound Name | tert-butyl N-(2-chloro-6-chlorooxy-5-ethyl-3-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 145402892 |
| Molecular Formula | C14H19Cl2NO4 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | tert-butyl N-(2-chloro-6-chlorooxy-5-ethyl-3-methoxyphenyl)carbamate |
| SMILES | CCc1cc(OC)c(Cl)c(NC(=O)OC(C)(C)C)c1OCl |
| InChI | InChI=1S/C14H19Cl2NO4/c1-6-8-7-9(19-5)10(15)11(12(8)21-16)17-13(18)20-14(2,3)4/h7H,6H2,1-5H3,(H,17,18) |
| InChIKey | PCSLVGYAVKAUFS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |