C30H34F3NO4S — CID 145403402
(E)-4-(10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-N-[4-(trifluoromethoxy)phenyl]sulfinylbut-2-enamide (PubChem CID 145403402) has the molecular formula C30H34F3NO4S and a molecular weight of 561.67 g/mol. Its IUPAC name is (E)-4-(10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-N-[4-(trifluoromethoxy)phenyl]sulfinylbut-2-enamide.
| Compound Name | (E)-4-(10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-N-[4-(trifluoromethoxy)phenyl]sulfinylbut-2-enamide |
|---|---|
| PubChem CID | 145403402 |
| Molecular Formula | C30H34F3NO4S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | (E)-4-(10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-N-[4-(trifluoromethoxy)phenyl]sulfinylbut-2-enamide |
| SMILES | CC12CCC(=O)C=C1C=CC1C2CCC2(C)C(C/C=C/C(=O)NS(=O)c3ccc(OC(F)(F)F)cc3)CCC12 |
| InChI | InChI=1S/C30H34F3NO4S/c1-28-17-15-26-24(12-6-20-18-21(35)14-16-29(20,26)2)25(28)13-7-19(28)4-3-5-27(36)34-39(37)23-10-8-22(9-11-23)38-30(31,32)33/h3,5-6,8-12,18-19,24-26H,4,7,13-17H2,1-2H3,(H,34,36)/b5-3+ |
| InChIKey | OHMNENUVJUOUQC-HWKANZROSA-N |
| XLogP | 6.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|