C26H35NO3S — CID 166647813
(E)-N-cyclopropylsulfinyl-4-[(10R)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]but-2-enamide (PubChem CID 166647813) has the molecular formula C26H35NO3S and a molecular weight of 441.64 g/mol. Its IUPAC name is (E)-N-cyclopropylsulfinyl-4-[(10R)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]but-2-enamide.
| Compound Name | (E)-N-cyclopropylsulfinyl-4-[(10R)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]but-2-enamide |
|---|---|
| PubChem CID | 166647813 |
| Molecular Formula | C26H35NO3S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (E)-N-cyclopropylsulfinyl-4-[(10R)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]but-2-enamide |
| SMILES | CC12CCC3C(C=CC4=CC(=O)CC[C@@]43C)C1CCC2C/C=C/C(=O)NS(=O)C1CC1 |
| InChI | InChI=1S/C26H35NO3S/c1-25-15-13-23-21(10-6-18-16-19(28)12-14-26(18,23)2)22(25)11-7-17(25)4-3-5-24(29)27-31(30)20-8-9-20/h3,5-6,10,16-17,20-23H,4,7-9,11-15H2,1-2H3,(H,27,29)/b5-3+/t17?,21?,22?,23?,25?,26-,31?/m0/s1 |
| InChIKey | VOUDOWKSDZFVAL-OVIMSOEXSA-N |
| XLogP | 4.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|