C19H32FNO3 — CID 145406328
tert-butyl N-ethyl-N-[(5E,7E)-5-ethyl-8-fluoro-1-hydroxy-4-methylidenenona-5,7-dien-3-yl]carbamate (PubChem CID 145406328) has the molecular formula C19H32FNO3 and a molecular weight of 341.47 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[(5E,7E)-5-ethyl-8-fluoro-1-hydroxy-4-methylidenenona-5,7-dien-3-yl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[(5E,7E)-5-ethyl-8-fluoro-1-hydroxy-4-methylidenenona-5,7-dien-3-yl]carbamate |
|---|---|
| PubChem CID | 145406328 |
| Molecular Formula | C19H32FNO3 |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | tert-butyl N-ethyl-N-[(5E,7E)-5-ethyl-8-fluoro-1-hydroxy-4-methylidenenona-5,7-dien-3-yl]carbamate |
| SMILES | C=C(/C(=C/C=C(\C)F)CC)C(CCO)N(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32FNO3/c1-8-16(11-10-14(3)20)15(4)17(12-13-22)21(9-2)18(23)24-19(5,6)7/h10-11,17,22H,4,8-9,12-13H2,1-3,5-7H3/b14-10+,16-11+ |
| InChIKey | IDFLQQVYBYNDAZ-LRHSVYTJSA-N |
| XLogP | 4.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|