C17H27NO3 — CID 164586113
tert-butyl (2S,4S)-4-hydroxy-2-[(3E)-2-methylhexa-1,3,5-trien-3-yl]piperidine-1-carboxylate (PubChem CID 164586113) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-hydroxy-2-[(3E)-2-methylhexa-1,3,5-trien-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-hydroxy-2-[(3E)-2-methylhexa-1,3,5-trien-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164586113 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | tert-butyl (2S,4S)-4-hydroxy-2-[(3E)-2-methylhexa-1,3,5-trien-3-yl]piperidine-1-carboxylate |
| SMILES | C=C/C=C(\C(=C)C)[C@@H]1C[C@@H](O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27NO3/c1-7-8-14(12(2)3)15-11-13(19)9-10-18(15)16(20)21-17(4,5)6/h7-8,13,15,19H,1-2,9-11H2,3-6H3/b14-8+/t13-,15-/m0/s1 |
| InChIKey | VUTIBUWNXMJSHR-LNLKOLKKSA-N |
| XLogP | 3.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|