C18H29NO3 — CID 91264604
3-(3-ethenylhexa-3,5-dien-2-yl)-6-(3-hydroxypropyl)-6-propan-2-yl-1,3-oxazinan-2-one (PubChem CID 91264604) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 3-(3-ethenylhexa-3,5-dien-2-yl)-6-(3-hydroxypropyl)-6-propan-2-yl-1,3-oxazinan-2-one.
| Compound Name | 3-(3-ethenylhexa-3,5-dien-2-yl)-6-(3-hydroxypropyl)-6-propan-2-yl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 91264604 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 3-(3-ethenylhexa-3,5-dien-2-yl)-6-(3-hydroxypropyl)-6-propan-2-yl-1,3-oxazinan-2-one |
| SMILES | C=CC=C(C=C)C(C)N1CCC(CCCO)(C(C)C)OC1=O |
| InChI | InChI=1S/C18H29NO3/c1-6-9-16(7-2)15(5)19-12-11-18(14(3)4,10-8-13-20)22-17(19)21/h6-7,9,14-15,20H,1-2,8,10-13H2,3-5H3 |
| InChIKey | CREQSYGGZDGTQR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|