C17H29NO3 — CID 10661564
tert-butyl 3-[(4E)-hepta-4,6-dienyl]-2-hydroxypiperidine-1-carboxylate (PubChem CID 10661564) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is tert-butyl 3-[(4E)-hepta-4,6-dienyl]-2-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4E)-hepta-4,6-dienyl]-2-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10661564 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | tert-butyl 3-[(4E)-hepta-4,6-dienyl]-2-hydroxypiperidine-1-carboxylate |
| SMILES | C=C/C=C/CCCC1CCCN(C(=O)OC(C)(C)C)C1O |
| InChI | InChI=1S/C17H29NO3/c1-5-6-7-8-9-11-14-12-10-13-18(15(14)19)16(20)21-17(2,3)4/h5-7,14-15,19H,1,8-13H2,2-4H3/b7-6+ |
| InChIKey | RFTSCAXNYGAQCN-VOTSOKGWSA-N |
| XLogP | 3.86 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|